| Name | 4-Nitrosophenol |
| Synonyms | quinone oxime nitrosophenol 2-nitrosophenol 4-Nitrosophenol quinone monoxime p-benzoquinone monoxime sodium 4-nitrosophenolate |
| CAS | 104-91-6 |
| EINECS | 203-251-6 |
| InChI | InChI=1/C6H5NO2/c8-6-4-2-1-3-5(6)7-9/h1-4,8H |
| Molecular Formula | C6H5NO2 |
| Molar Mass | 123.109 |
| Density | 1.236g/cm3 |
| Melting Point | 132-144℃ |
| Boling Point | 241.822°C at 760 mmHg |
| Flash Point | 100.051°C |
| Water Solubility | <0.1 g/100 mL at 21℃ |
| Vapor Presure | 0.023mmHg at 25°C |
| Refractive Index | 1.564 |
| Physical and Chemical Properties | Characteristic light yellow needle-like crystals. melting point 126~128 ℃ solubility: soluble in ethanol, ether, acetone, slightly soluble in water, soluble in alkali solution, Brown, diluted into green. |
light yellow needle-like crystals. The melting point was 126-128 °c. The decomposition point was 144 °c. Brown at 126 ℃. Soluble in ethanol, ether, acetone, slightly soluble in water, soluble in alkali Brown, diluted into green. If mixed with impurities, contact with concentrated acid, alkali or flame, will cause combustion or explosion.
p-nitrochlorobenzene was hydrolyzed under heating and pressure in sodium hydroxide solution. After reaction, cooling, acidification, re-cooling, crystallization, centrifugal separation, to obtain the finished product.
organic intermediates, can be used for the production of rubber crosslinking agent, vulcanized blue BRN, vulcanized blue BBF, vulcanized reduction blue RNX. Can also produce antipyretic analgesic paracetamol and so on.